2-acetamido-5-bromobenzoic acid structure
|
Common Name | 2-acetamido-5-bromobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 38985-79-4 | Molecular Weight | 258.06900 | |
| Density | 1.706g/cm3 | Boiling Point | 457.8ºC at 760mmHg | |
| Molecular Formula | C9H8BrNO3 | Melting Point | 218ºC | |
| MSDS | Chinese USA | Flash Point | 230.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-acetamido-5-bromobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.706g/cm3 |
|---|---|
| Boiling Point | 457.8ºC at 760mmHg |
| Melting Point | 218ºC |
| Molecular Formula | C9H8BrNO3 |
| Molecular Weight | 258.06900 |
| Flash Point | 230.7ºC |
| Exact Mass | 256.96900 |
| PSA | 66.40000 |
| LogP | 2.17870 |
| Appearance of Characters | Crystals or Crystalline Powder | Pale brown |
| Index of Refraction | 1.6200 (estimate) |
| InChIKey | QVABAFHRLMDDLM-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(Br)cc1C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 22 |
| Safety Phrases | S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-acetylamino-5-bromo-benzoic acid |
| 5-bromo-N-acetylanthranilic acid |
| 2-Acetylamino-5-brom-benzoesaeure |
| MFCD00040904 |
| N-Acetyl-5-brom-anthranilsaeure |
| 2-Acetamido-5-bromobenzoic acid |
| N-ACETYL-5-BROMOANTHRANILIC ACID |
| 5-Brom-2-acetamino-benzoesaeure |