Dimethyl 4-chloropyridine-2,6-dicarboxylate structure
|
Common Name | Dimethyl 4-chloropyridine-2,6-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 5371-70-0 | Molecular Weight | 229.617 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 355.2±37.0 °C at 760 mmHg | |
| Molecular Formula | C9H8ClNO4 | Melting Point | 168ºC | |
| MSDS | N/A | Flash Point | 168.6±26.5 °C | |
| Name | Dimethyl 4-Chloropyridine-2,6-Dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 355.2±37.0 °C at 760 mmHg |
| Melting Point | 168ºC |
| Molecular Formula | C9H8ClNO4 |
| Molecular Weight | 229.617 |
| Flash Point | 168.6±26.5 °C |
| Exact Mass | 229.014191 |
| PSA | 65.49000 |
| LogP | 1.12 |
| Appearance of Characters | Solid | Pale yellow |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | NFXKYKHKNUFOKB-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(Cl)cc(C(=O)OC)n1 |
| Storage condition | 2-8°C |
| Water Solubility | Slightly soluble in water. |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 20/21/22 |
| Safety Phrases | 24/25-36/37 |
| HS Code | 2933399090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-Pyridinedicarboxylic acid, 4-chloro-, dimethyl ester |
| Dimethyl 4-chloro-2,6-pyridinedicarboxylate |
| dimethyl 4-chloropyridine-2,6-dicarboxylate |