Boc-Tyr(tBu)-OH structure
|
Common Name | Boc-Tyr(tBu)-OH | ||
|---|---|---|---|---|
| CAS Number | 47375-34-8 | Molecular Weight | 337.411 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 484.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C18H27NO5 | Melting Point | 113-118 °C | |
| MSDS | Chinese USA | Flash Point | 246.5±27.3 °C | |
Use of Boc-Tyr(tBu)-OHBoc-Tyr(tBu)-OH is a tyrosine derivative[1]. |
| Name | Boc-O-tert-butyl-L-tyrosine |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-Tyr(tBu)-OH is a tyrosine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 484.0±40.0 °C at 760 mmHg |
| Melting Point | 113-118 °C |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.411 |
| Flash Point | 246.5±27.3 °C |
| Exact Mass | 337.188934 |
| PSA | 84.86000 |
| LogP | 4.11 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | ZEQLLMOXFVKKCN-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccc(OC(C)(C)C)cc1)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~76%
Boc-Tyr(tBu)-OH CAS#:47375-34-8 |
| Literature: Atherton, Eric; Caviezel, Mario; Fox, Hazel; Harkiss, Diana; Over, Hilary; Sheppard, Robert C. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 1 p. 65 - 73 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Fluorescently labeled adrenomedullin allows real-time monitoring of adrenomedullin receptor trafficking in living cells.
J. Pept. Sci. 21 , 905-12, (2016) The human adrenomedullin (ADM) is a 52 amino acid peptide hormone belonging to the calcitonin family of peptides, which plays a major role in the development and regulation of cardiovascular and lymph... |
| N-(tert-Butoxycarbonyl)-O-tert-butyl-L-tyrosine |
| O-(2-Methyl-2-propanyl)-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-tyrosine |
| MFCD00065598 |
| Boc-Tyr(Tbu)-OH |
| (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid |
| Boc-Tyr(But)-OH |