Epitestosterone structure
|
Common Name | Epitestosterone | ||
|---|---|---|---|---|
| CAS Number | 481-30-1 | Molecular Weight | 288.424 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 432.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H28O2 | Melting Point | 218-220ºC | |
| MSDS | N/A | Flash Point | 184.7±21.3 °C | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
| Name | epitestosterone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 432.9±45.0 °C at 760 mmHg |
| Melting Point | 218-220ºC |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.424 |
| Flash Point | 184.7±21.3 °C |
| Exact Mass | 288.208923 |
| PSA | 37.30000 |
| LogP | 3.47 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | MUMGGOZAMZWBJJ-KZYORJDKSA-N |
| SMILES | CC12CCC(=O)C=C1CCC1C2CCC2(C)C(O)CCC12 |
| Storage condition | Refrigerator |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H302 + H312 + H332-H319 |
| Precautionary Statements | P210-P261-P302 + P352 + P312-P304 + P340 + P312-P337 + P313-P403 + P235 |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R68 |
| Safety Phrases | 22-36 |
| RIDADR | UN 1648 3 / PGII |
| WGK Germany | 3 |
| RTECS | BV8395600 |
| HS Code | 2914400020 |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914400020 |
|---|
|
Analysis of anabolic androgenic steroids in urine by full-capillary sample injection combined with a sweeping CE stacking method.
Anal. Bioanal. Chem 405(6) , 1969-76, (2013) This study describes an on-line stacking CE approach by sweeping with whole capillary sample filling for analyzing five anabolic androgenic steroids in urine samples. The five anabolic steroids for de... |
|
|
Relevance of the selective oestrogen receptor modulators tamoxifen, toremifene and clomiphene in doping field: endogenous steroids urinary profile after multiple oral doses.
Steroids 76(12) , 1400-6, (2011) The present study was performed to investigate the influence of the intake of selective oestrogen receptor modulators on the urinary endogenous steroids profile. For this purpose the circadian variabi... |
|
|
UDP-glucuronosyltransferase 2B17 genotyping in Japanese athletes and evaluation of the current sports drug testing for detecting testosterone misuse.
Drug Test. Anal. 5(3) , 166-81, (2013) Ethnicity has been found to influence urinary testosterone glucuronide to epitestosterone glucuronide (T/E) ratios among athletes. Uridine diphospho-glucuronosyltransferase 2B17 (UGT2B17) is the most ... |
| Isotestosterone |
| (8R,9S,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
| 17a-Testosterone |
| 17α-Hydroxyandrost-4-en-3-one |
| 17alpha-Testosterone |
| cis-Testosterone |
| 17a-hydroxy-androst-4-en-3-one |
| 17-Epitestosterone |
| 17α-Testosterone |
| 17-epi-testosterone |
| (17α)-17-Hydroxyandrost-4-en-3-one |
| Epitestosterone |
| 17alpha-Hydroxyandrost-4-en-3-one |
| α epitestosterone |
| UNII-48L726977Z |
| Androst-4-en-3-one, 17-hydroxy-, (17α)- |
| 17a-Epitestosterone |
| MFCD00067129 |
| 17a-cis-Testosterone |
| EINECS 200-835-2 |
| Androst-4-en-3-one, 17α-hydroxy- |
| epi-Testosterone |