Guanidine,N,N',N''-tricyclohexyl
Guanidine,N,N',N''-tricyclohexyl structure
|
Common Name | Guanidine,N,N',N''-tricyclohexyl | ||
|---|---|---|---|---|
| CAS Number | 4833-41-4 | Molecular Weight | 305.50100 | |
| Density | 1.14g/cm3 | Boiling Point | 430.6ºC at 760mmHg | |
| Molecular Formula | C19H35N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.2ºC | |
Summary: 1,2,3-Tricyclohexylguanidine (Chinese name: 1,2,3-三环己基胍, CAS number: 4833-41-4, molecular formula: C19H35N3, molecular weight: 305.50100), For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,3-tricyclohexylguanidine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 430.6ºC at 760mmHg |
| Molecular Formula | C19H35N3 |
| Molecular Weight | 305.50100 |
| Flash Point | 214.2ºC |
| Exact Mass | 305.28300 |
| PSA | 36.42000 |
| LogP | 5.30150 |
| Index of Refraction | 1.602 |
| InChIKey | FTWMCSGJSZWKCR-UHFFFAOYSA-N |
| SMILES | C1CCC(N=C(NC2CCCCC2)NC2CCCCC2)CC1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 0 | |
CAS#:108-91-8
CAS#:538-75-0![Cy-N=C[N(CH3)2]NH-Cy Structure](https://image.chemsrc.com/caspic/351/29882-02-8.png)
CAS#:29882-02-8
CAS#:4998-76-9
CAS#:141-97-9
CAS#:123-54-6
CAS#:2666-80-0
CAS#:431-03-8
CAS#:2387-23-7
CAS#:613-92-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N,N',N''-tris(cyclohexyl)guanidine |
| tricyclohexylguanidine |
| N,N',N''-tricyclohexylguanidine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1,2,3-tricyclohexylguanidine? |
| A: LogP of 1,2,3-tricyclohexylguanidine is 5.30150. |
| Q: What is the polar surface area (PSA) of 1,2,3-tricyclohexylguanidine? |
| A: Polar surface area (PSA) of 1,2,3-tricyclohexylguanidine is 36.42000. |
| Q: What is the English name of 1,2,3-tricyclohexylguanidine? |
| A: The English name of 1,2,3-tricyclohexylguanidine is 1,2,3-tricyclohexylguanidine. |
| Q: What is the InChIKey of 1,2,3-tricyclohexylguanidine? |
| A: InChIKey of 1,2,3-tricyclohexylguanidine is FTWMCSGJSZWKCR-UHFFFAOYSA-N. |
| Q: What English synonyms does 1,2,3-tricyclohexylguanidine have? |
| A: English synonyms of 1,2,3-tricyclohexylguanidine: N,N',N''-tris(cyclohexyl)guanidine, tricyclohexylguanidine, N,N',N''-tricyclohexylguanidine. |
| Q: What is the SMILES notation of 1,2,3-tricyclohexylguanidine? |
| A: SMILES notation of 1,2,3-tricyclohexylguanidine is C1CCC(N=C(NC2CCCCC2)NC2CCCCC2)CC1. |
| Q: What are the upstream materials of 1,2,3-tricyclohexylguanidine? |
| A: Related upstream materials(CAS) of 1,2,3-tricyclohexylguanidine: 108-91-8;538-75-0;29882-02-8;4998-76-9;141-97-9;123-54-6;2666-80-0;431-03-8;2387-23-7;613-92-3. |
| Q: What is the CAS number of 1,2,3-tricyclohexylguanidine? |
| A: CAS number of 1,2,3-tricyclohexylguanidine is 4833-41-4. |
| Q: What is the molecular weight of 1,2,3-tricyclohexylguanidine? |
| A: Molecular weight of 1,2,3-tricyclohexylguanidine is 305.50100. |
| Q: What is the Chinese name of 4833-41-4? |
| A: Chinese name of 4833-41-4 is 4833-41-4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |