Robustaflavone structure
|
Common Name | Robustaflavone | ||
|---|---|---|---|---|
| CAS Number | 49620-13-5 | Molecular Weight | 538.46 | |
| Density | 1.656g/cm3 | Boiling Point | 926.8ºC at 760 mmHg | |
| Molecular Formula | C30H18O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.9ºC | |
Use of RobustaflavoneRobustaflavone is a biflavonoid isolated from Doradilla that has natriuretic properties[1]. |
| Name | robustaflavone |
|---|---|
| Synonym | More Synonyms |
| Description | Robustaflavone is a biflavonoid isolated from Doradilla that has natriuretic properties[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.656g/cm3 |
|---|---|
| Boiling Point | 926.8ºC at 760 mmHg |
| Molecular Formula | C30H18O10 |
| Molecular Weight | 538.46 |
| Flash Point | 313.9ºC |
| Exact Mass | 538.09000 |
| PSA | 181.80000 |
| LogP | 5.13400 |
| Index of Refraction | 1.793 |
| InChIKey | BORWSEZUWHQTOK-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccc(O)c(-c3c(O)cc4oc(-c5ccc(O)cc5)cc(=O)c4c3O)c2)oc2cc(O)cc(O)c12 |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| Robustaflavone |
| 6-[5-(5,7-dihydroxy-4-oxochromen-2-yl)-2-hydroxyphenyl]-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| 3',6''-Biapigenin |