HhAntag structure
|
Common Name | HhAntag | ||
|---|---|---|---|---|
| CAS Number | 496794-70-8 | Molecular Weight | 450.91700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H23ClN4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HhAntagHhAntag is a small molecule inhibitor of GLI1-mediated transcription, an essential down-stream element of the Hedgehog (Hh) pathway; antitumor agent.IC50 value:Target: Gli |
| Name | N-[4-chloro-3-[6-(dimethylamino)-1H-benzimidazol-2-yl]phenyl]-3,5-dimethoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Description | HhAntag is a small molecule inhibitor of GLI1-mediated transcription, an essential down-stream element of the Hedgehog (Hh) pathway; antitumor agent.IC50 value:Target: Gli |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H23ClN4O3 |
|---|---|
| Molecular Weight | 450.91700 |
| Exact Mass | 450.14600 |
| PSA | 82.97000 |
| LogP | 5.60280 |
| InChIKey | UBHJFPVTEATUFS-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc(Cl)c(-c3nc4ccc(N(C)C)cc4[nH]3)c2)c1 |
| Storage condition | 2-8℃ |
| CS-1233 |
| GLI1-mediated tranion inhibitor |
| HhAntag |