RP106 structure
|
Common Name | RP106 | ||
|---|---|---|---|---|
| CAS Number | 496864-15-4 | Molecular Weight | 267.32600 | |
| Density | 1.155g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H17N3O | Melting Point | 182-184ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of RP106Aloisine RP106 (compound 38) is a potent inhibitor of Cdk1/cyclin B, Cdk5/p25, and GSK3 with IC50s of 0.70µM, 1.5µM, 0.92 µM, respectively[1]. |
| Name | Aloisine RP106 |
|---|---|
| Synonym | More Synonyms |
| Description | Aloisine RP106 (compound 38) is a potent inhibitor of Cdk1/cyclin B, Cdk5/p25, and GSK3 with IC50s of 0.70µM, 1.5µM, 0.92 µM, respectively[1]. |
|---|---|
| Related Catalog | |
| Target |
Cdk1/cyclin B:0.7 μM (IC50) Cdk5/p25:1.5 μM (IC50) GSK-3:0.92 μM (IC50) |
| References |
| Density | 1.155g/cm3 |
|---|---|
| Melting Point | 182-184ºC |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.32600 |
| Exact Mass | 267.13700 |
| PSA | 61.80000 |
| LogP | 3.67310 |
| Index of Refraction | 1.613 |
| InChIKey | WVMANZPBOBRWCB-UHFFFAOYSA-N |
| SMILES | CCCCc1c(-c2ccc(OC)cc2)[nH]c2nccnc12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335-H413 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn |
| RIDADR | NONH for all modes of transport |
| 7-butyl-6-(4-methoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine |
| 7-n-Butyl-6-(4-hydroxyphenyl)[5H]-pyrrolo[2,3-b]pyrazine |