HM03 structure
|
Common Name | HM03 | ||
|---|---|---|---|---|
| CAS Number | 500565-15-1 | Molecular Weight | 499.43200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H27ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HM03HM03 is a potent and selective HSPA5 (Heat shock 70kDa protein 5, also known as Bip, Grp78) inhibitor. HM03 has anticancer activity[1]. |
| Name | 4-[(6-chloro-2-methoxyacridin-10-ium-9-yl)amino]-2-[(4-methylpiperazin-1-yl)methyl]phenol,chloride |
|---|
| Description | HM03 is a potent and selective HSPA5 (Heat shock 70kDa protein 5, also known as Bip, Grp78) inhibitor. HM03 has anticancer activity[1]. |
|---|---|
| Related Catalog | |
| Target |
HSPA5 |
| In Vitro | HM03 (0.1-50 μM; 72 hours) exhibits over 50% inhibition at 25 µM concentration in HCT116 cells[1]. HM03 forms more binding interactions with HSPA5 and HSPA9 than with the other HSP70 proteins[1]. HM03 exhibits promising inhibition activities from cancer cell viability and tumor inhibition assays[1]. Cell Viability Assay[1] Cell Line: HCT116 cells Concentration: 0.1, 1, 10, 25, 50 μM Incubation Time: 72 hours Result: Exhibited prominent inhibition effect (18% survival at 25 µM). |
| References |
| Molecular Formula | C26H27ClN4O2 |
|---|---|
| Molecular Weight | 499.43200 |
| Exact Mass | 498.15900 |
| PSA | 64.09000 |
| LogP | 5.34630 |
| InChIKey | SUSDGTMJKOGWSZ-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(Nc3ccc(O)c(CN4CCN(C)CC4)c3)c2c1 |