4,4-dinitroheptanedioic acid structure
|
Common Name | 4,4-dinitroheptanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 5029-40-3 | Molecular Weight | 250.16300 | |
| Density | 1.573g/cm3 | Boiling Point | 496.4ºC at 760 mmHg | |
| Molecular Formula | C7H10N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.5ºC | |
| Name | 4,4-dinitroheptanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.573g/cm3 |
|---|---|
| Boiling Point | 496.4ºC at 760 mmHg |
| Molecular Formula | C7H10N2O8 |
| Molecular Weight | 250.16300 |
| Flash Point | 217.5ºC |
| Exact Mass | 250.04400 |
| PSA | 166.24000 |
| LogP | 1.01210 |
| Index of Refraction | 1.536 |
| InChIKey | WVXNFQGAMQFCSX-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(CCC(=O)O)([N+](=O)[O-])[N+](=O)[O-] |
| HS Code | 2917190090 |
|---|
|
~95%
4,4-dinitrohept... CAS#:5029-40-3 |
| Literature: TOTALFOeRSVARETS FORKSNINGSINSTITUT; DEFENCE SCIENCE AND TECHNOLOGY AGENCY (DSTA) Patent: WO2009/72955 A1, 2009 ; Location in patent: Page/Page column 7 ; |
|
~%
4,4-dinitrohept... CAS#:5029-40-3 |
| Literature: Zeldin; Shechter Journal of the American Chemical Society, 1957 , vol. 79, p. 4708,4712 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4,4-Dinitro-heptanedioic acid |
| 4,4-dinitro-1,7-heptanedioic acid |
| 4,4-Dinitro-heptan-1,7-disaeure |
| Heptanedioic acid,4-dinitro |
| 4,4-Dinitro-pimelinsaeure |
| 4,4-dinitropimelic acid |
| 4,4-Dinitro-heptandisaeure |