2,4-diphenylthiazole-5-carboxylic acid structure
|
Common Name | 2,4-diphenylthiazole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 502935-47-9 | Molecular Weight | 281.32900 | |
| Density | 1.307g/cm3 | Boiling Point | 484.1ºC at 760 mmHg | |
| Molecular Formula | C16H11NO2S | Melting Point | 212ºC | |
| MSDS | N/A | Flash Point | 246.6ºC | |
| Name | 2,4-diphenyl-1,3-thiazole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.307g/cm3 |
|---|---|
| Boiling Point | 484.1ºC at 760 mmHg |
| Melting Point | 212ºC |
| Molecular Formula | C16H11NO2S |
| Molecular Weight | 281.32900 |
| Flash Point | 246.6ºC |
| Exact Mass | 281.05100 |
| PSA | 78.43000 |
| LogP | 4.17530 |
| Index of Refraction | 1.653 |
| InChIKey | KMOCHRNIGWCEJV-UHFFFAOYSA-N |
| SMILES | O=C(O)c1sc(-c2ccccc2)nc1-c1ccccc1 |
| HS Code | 2934100090 |
|---|
|
~94%
2,4-diphenylthi... CAS#:502935-47-9 |
| Literature: Herrero, M.Teresa; Tellitu, Imanol; Dominguez, Esther; Hernandez, Susana; Moreno, Isabel; SanMartin, Raul Tetrahedron, 2002 , vol. 58, # 42 p. 8581 - 8589 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2,4-DIBROMOPYRIDINE HYDROBROMIDE |
| 2,4-diphenylthiazole-5-carboxylic acid |