2,4-diphenyl-1,3-thiazole-5-carbonyl chloride structure
|
Common Name | 2,4-diphenyl-1,3-thiazole-5-carbonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 857284-13-0 | Molecular Weight | 299.77500 | |
| Density | 1.308g/cm3 | Boiling Point | 486.5ºC at 760 mmHg | |
| Molecular Formula | C16H10ClNOS | Melting Point | 139ºC | |
| MSDS | N/A | Flash Point | 248ºC | |
| Name | 2,4-diphenyl-1,3-thiazole-5-carbonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.308g/cm3 |
|---|---|
| Boiling Point | 486.5ºC at 760 mmHg |
| Melting Point | 139ºC |
| Molecular Formula | C16H10ClNOS |
| Molecular Weight | 299.77500 |
| Flash Point | 248ºC |
| Exact Mass | 299.01700 |
| PSA | 58.20000 |
| LogP | 4.85610 |
| Index of Refraction | 1.636 |
| InChIKey | DHGZZGFKARJISD-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1sc(-c2ccccc2)nc1-c1ccccc1 |
| Risk Phrases | 14-29-34 |
|---|---|
| Safety Phrases | 8-22-26-30-36/37/39-45 |
| RIDADR | UN 3261 |
| HS Code | 2934100090 |
|
~%
2,4-diphenyl-1,... CAS#:857284-13-0 |
| Literature: Herrero, M.Teresa; Tellitu, Imanol; Dominguez, Esther; Hernandez, Susana; Moreno, Isabel; SanMartin, Raul Tetrahedron, 2002 , vol. 58, # 42 p. 8581 - 8589 |
|
~%
2,4-diphenyl-1,... CAS#:857284-13-0 |
| Literature: Herrero, M.Teresa; Tellitu, Imanol; Dominguez, Esther; Hernandez, Susana; Moreno, Isabel; SanMartin, Raul Tetrahedron, 2002 , vol. 58, # 42 p. 8581 - 8589 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2,4-diphenylthiazole-5-carbonyl chloride |
| OR3800 |
| 5-Thiazolecarbonylchloride,2,4-diphenyl |