Methyl p-toluenesulfonylacetate structure
|
Common Name | Methyl p-toluenesulfonylacetate | ||
|---|---|---|---|---|
| CAS Number | 50397-64-3 | Molecular Weight | 228.26500 | |
| Density | 1.24g/cm3 | Boiling Point | 383.3ºC at 760 mmHg | |
| Molecular Formula | C10H12O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.6ºC | |
| Name | methyl 2-(4-methylphenyl)sulfonylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 383.3ºC at 760 mmHg |
| Molecular Formula | C10H12O4S |
| Molecular Weight | 228.26500 |
| Flash Point | 185.6ºC |
| Exact Mass | 228.04600 |
| PSA | 68.82000 |
| LogP | 2.02250 |
| Index of Refraction | 1.535 |
| InChIKey | JMUZMDKWJWSBCU-UHFFFAOYSA-N |
| SMILES | COC(=O)CS(=O)(=O)c1ccc(C)cc1 |
| Safety Phrases | S24/25 |
|---|---|
| HS Code | 2916399090 |
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| methyl para-toluene sulphonyl acetate |
| methyl 2-tosylacetate |
| methyl p-methylphenylsulfonylacetate |
| methyl para-toluenesulfonylacetate |
| methyl tosylacetate |
| MFCD00025885 |