Methyl 2-(4-nitrophenyl)propanoate
Modify Date: 2025-08-25 16:18:06
Methyl 2-(4-nitrophenyl)propanoate structure
|
Common Name | Methyl 2-(4-nitrophenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 50415-69-5 | Molecular Weight | 209.19900 | |
| Density | 1.22g/cm3 | Boiling Point | 305.7ºC at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.8ºC | |
| Name | Methyl 2-(4-nitrophenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 305.7ºC at 760 mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.19900 |
| Flash Point | 132.8ºC |
| Exact Mass | 209.06900 |
| PSA | 72.12000 |
| LogP | 2.39450 |
| Index of Refraction | 1.535 |
| InChIKey | NWHFCRJVWNLNHP-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2916399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 2 | |
![2-[4-(pyridin-2-ylamino)phenyl]propanoic acid structure](https://image.chemsrc.com/caspic/494/76302-29-9.png)
CAS#:76302-29-9| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| methyl (4-nitrophenyl)propanoate |
| methylnitrophenylpropanoate |
| (+-)-2-(4-Nitro-phenyl)-propionsaeure-methylester |
| methyl 2-(4-nitrobenzene)propionate |
| EINECS 256-584-4 |
| (+-)-2-(4-nitro-phenyl)-propionic acid methyl ester |
| methyl 2-(4-nitrophenyl)propionate |