Bis(3-chlorophenyl) sulfide structure
|
Common Name | Bis(3-chlorophenyl) sulfide | ||
|---|---|---|---|---|
| CAS Number | 5097-96-1 | Molecular Weight | 255.16300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8Cl2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-3-(3-chlorophenyl)sulfanylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8Cl2S |
|---|---|
| Molecular Weight | 255.16300 |
| Exact Mass | 253.97200 |
| PSA | 25.30000 |
| LogP | 5.14460 |
| InChIKey | VECFIRWWXYYZIG-UHFFFAOYSA-N |
| SMILES | Clc1cccc(Sc2cccc(Cl)c2)c1 |
| HS Code | 2930909090 |
|---|
|
~61%
Bis(3-chlorophe... CAS#:5097-96-1 |
| Literature: Kosugi, Masanori; Ogata, Toshimi; Terada, Masahiro; Sano, Hiroshi; Migita, Toshihiko Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 12 p. 3657 - 3658 |
|
~%
Bis(3-chlorophe... CAS#:5097-96-1 |
| Literature: Leandri et al. Gazzetta Chimica Italiana, 1954 , vol. 84, p. 3,20 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,3'-dichlorodiphenyl sulfide |
| 3,3'-Dichlordiphenylsulfid |
| m,m'-Dichlor-diphenylsulfid |
| Bis-<3-chlor-phenyl>-sulfid |