Minecoside structure
|
Common Name | Minecoside | ||
|---|---|---|---|---|
| CAS Number | 51005-44-8 | Molecular Weight | 538.50 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 815.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C25H30O13 | Melting Point | 142℃ | |
| MSDS | Chinese USA | Flash Point | 275.7±27.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of MinecosideMinecoside is a CXCR4/STAT3 inhibitor with anticancer and anti-inflammatory activity. Minecoside decreases CXCR4 expression and suppresses STAT3 activation, thus to inhibit CXCL 12-induced invasion. Minecoside potently inhibits cancer metastasis and promotes apoptotic progression[1][2]. |
| Name | (1aS,1bS,2S,5aR,6S,6aS)-2-(β-D-Glucopyranosyloxy)-1a-(hydroxymeth yl)-1a,1b,2,5a,6,6a-hexahydrooxireno[4,5]cyclopenta[1,2-c]pyran-6 -yl (2E)-3-(3-hydroxy-4-methoxyphenyl)acrylate |
|---|---|
| Synonym | More Synonyms |
| Description | Minecoside is a CXCR4/STAT3 inhibitor with anticancer and anti-inflammatory activity. Minecoside decreases CXCR4 expression and suppresses STAT3 activation, thus to inhibit CXCL 12-induced invasion. Minecoside potently inhibits cancer metastasis and promotes apoptotic progression[1][2]. |
|---|---|
| Related Catalog | |
| Target |
CXCR4; STAT3 |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 815.9±65.0 °C at 760 mmHg |
| Melting Point | 142℃ |
| Molecular Formula | C25H30O13 |
| Molecular Weight | 538.50 |
| Flash Point | 275.7±27.8 °C |
| Exact Mass | 538.168640 |
| PSA | 197.13000 |
| LogP | -2.66 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.678 |
| InChIKey | LRHHPZILMPIMIY-VOACHAMZSA-N |
| SMILES | COc1ccc(C=CC(=O)OC2C3C=COC(OC4OC(CO)C(O)C(O)C4O)C3C3(CO)OC23)cc1O |
| Storage condition | ?20°C |
| (1aS,1bS,2S,5aR,6S,6aS)-2-(β-D-Glucopyranosyloxy)-1a-(hydroxymethyl)-1a,1b,2,5a,6,6a-hexahydrooxireno[4,5]cyclopenta[1,2-c]pyran-6-yl (2E)-3-(3-hydroxy-4-methoxyphenyl)acrylate |
| 2-Propenoic acid, 3-(3-hydroxy-4-methoxyphenyl)-, (1aS,1bS,2S,5aR,6S,6aS)-2-(β-D-glucopyranosyloxy)-1a,1b,2,5a,6,6a-hexahydro-1a-(hydroxymethyl)oxireno[4,5]cyclopenta[1,2-c]pyran-6-yl ester, (2E)- |