(S)-1-(tert-Butoxycarbonyl)-2,5-dihydro-1H-pyrrole-2-carboxylic acid structure
|
Common Name | (S)-1-(tert-Butoxycarbonyl)-2,5-dihydro-1H-pyrrole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 51154-06-4 | Molecular Weight | 213.230 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 336.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H15NO4 | Melting Point | 92-95ºC | |
| MSDS | Chinese USA | Flash Point | 157.3±27.9 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-2,5-dihydropyrrole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 336.4±42.0 °C at 760 mmHg |
| Melting Point | 92-95ºC |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.230 |
| Flash Point | 157.3±27.9 °C |
| Exact Mass | 213.100113 |
| PSA | 66.84000 |
| LogP | 0.53 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | BMIGSRMSSCUMAZ-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC=CC1C(=O)O |
| Storage condition | 2-8°C |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319-H400 |
| Precautionary Statements | P273-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi,N |
| Risk Phrases | R36 |
| Safety Phrases | 26-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| HS Code | 2933990090 |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Peptide analogues compete with the binding of alpha-factor to its receptor in Saccharomyces cerevisiae.
J. Biol. Chem. 263 , 17333-17341, (1988) alpha-Factor, a secreted tridecapeptide pheromone, is required for mating between the a- and alpha-haploid mating types of Saccharomyces cerevisiae. An analogue of alpha-factor, [DHP8,DHP11,Nle12] tri... |
| N-tert-Butoxycarbonyl-(S)-dehydroproline |
| (2S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2,5-dihydro-1H-pyrrole-2-carboxylic acid |
| (2S)-1-(tert-butoxycarbonyl)-2,5-dihydro-1H-pyrrole-2-carboxylic acid |
| (S)-1-Boc-2,5-dihydro-1H-pyrrole-2-carboxylic acid |
| Boc-3,4-Dehydro-L-proline |
| MFCD00037896 |
| Boc-3,4-Dehydro-Pro-OH |
| (S)-2,5-dihydropyrrole-1,2-dicarboxylic acid 1-tert-butyl ester |
| AmbotzBAA1460 |