methyl n-boc-l-proline-3-ene structure
|
Common Name | methyl n-boc-l-proline-3-ene | ||
|---|---|---|---|---|
| CAS Number | 74844-93-2 | Molecular Weight | 227.257 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 287.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C11H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.6±27.3 °C | |
| Name | 1-O-tert-butyl 2-O-methyl (2S)-2,5-dihydropyrrole-1,2-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 287.3±40.0 °C at 760 mmHg |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.257 |
| Flash Point | 127.6±27.3 °C |
| Exact Mass | 227.115753 |
| PSA | 55.84000 |
| LogP | 0.99 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.492 |
| InChIKey | YDQDZLXTPXNOKO-QMMMGPOBSA-N |
| SMILES | COC(=O)C1C=CCN1C(=O)OC(C)(C)C |
| Storage condition | Store at 0-5°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Pyrrole-1,2-dicarboxylic acid, 2,5-dihydro-, 1-(1,1-dimethylethyl) 2-methyl ester, (2S)- |
| N-Boc-L-proline-3-ene |
| methyl (2S)-N-tert-butyloxycarbonyl-3,4-dehydroprolinate |
| (S)-N-Boc-3,4-dehydroprolone methyl ester |
| 1-TERT-BUTYL 2-METHYL (2S)-2,5-DIHYDRO-1H-PYRROLE-1,2-DICARBOXYLATE |
| (2S)-N-(tert-Butoxycarbonyl)-2-methoxycarbonyl-3-pyrroline |
| (S)-N-Boc-3,4-didehydroproline methyl ester |
| N-Boc-3,4-dehydro-L-proline methyl ester |
| 2-Methyl 1-(2-methyl-2-propanyl) (2S)-2,5-dihydro-1H-pyrrole-1,2-dicarboxylate |
| (S)-1-tert-Butyl 2-methyl 1H-pyrrole-1,2(2H,5H)-dicarboxylate |
| methyl N-BOC-3,4-didehydro-(S)-prolinate |
| Boc-3,4-dehydro-L-proline methyl ester |
| N-BOC-3,4-didehydro-(S)-proline methyl ester |
| (S)-2,5-Dihydro-pyrrole-1,2-dicarboxylic acid 1-tert-butyl ester 2-methyl ester |
| Methyl n-boc-l-proline-3-ene |