N-Phthaloyl-L-phenylalanine structure
|
Common Name | N-Phthaloyl-L-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 5123-55-7 | Molecular Weight | 295.289 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 498.0±38.0 °C at 760 mmHg | |
| Molecular Formula | C17H13NO4 | Melting Point | 181-185ºC | |
| MSDS | Chinese USA | Flash Point | 255.0±26.8 °C | |
| Name | N-Phthaloyl-L-phenylalanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 498.0±38.0 °C at 760 mmHg |
| Melting Point | 181-185ºC |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.289 |
| Flash Point | 255.0±26.8 °C |
| Exact Mass | 295.084473 |
| PSA | 74.68000 |
| LogP | 3.40 |
| Appearance of Characters | Powder | White |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.660 |
| InChIKey | VAYRSTHMTWUHGE-AWEZNQCLSA-N |
| SMILES | O=C(O)C(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| Storage condition | 2-8°C |
| Water Solubility | Soluble in methanol. (almost transparency) |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2925190090 |
| Precursor 9 | |
|---|---|
| DownStream 6 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2H-Isoindole-2-acetic acid, 1,3-dihydro-1,3-dioxo-α-(phenylmethyl)-, (αS)- |
| 2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)-3-phenylpropanoic acid |
| N-Pht-Phe-OH |
| N-Phthaloyl-Phe-OH |
| (2S)-2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoic acid |
| (2S)-2-(1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)-3-phenylpropanoic acid |
| MFCD00069738 |
| 2H-Isoindole-2-acetic acid, 1,3-dihydro-1,3-dioxo-α-(phenylmethyl)- |