ethyl 2-(4-formylphenoxy)propionate structure
|
Common Name | ethyl 2-(4-formylphenoxy)propionate | ||
|---|---|---|---|---|
| CAS Number | 51264-73-4 | Molecular Weight | 222.23700 | |
| Density | 1.139g/cm3 | Boiling Point | 335.9ºC at 760mmHg | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.5ºC | |
| Name | ethyl 2-(4-formylphenoxy)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.139g/cm3 |
|---|---|
| Boiling Point | 335.9ºC at 760mmHg |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.23700 |
| Flash Point | 147.5ºC |
| Exact Mass | 222.08900 |
| PSA | 52.60000 |
| LogP | 1.82950 |
| Index of Refraction | 1.527 |
| InChIKey | LGKWYOQEGGBNPN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)Oc1ccc(C=O)cc1 |
| HS Code | 2918990090 |
|---|
|
~%
ethyl 2-(4-form... CAS#:51264-73-4 |
| Literature: Nissan Chemical Industries Ltd. Patent: US4537984 A1, 1985 ; |
|
~%
ethyl 2-(4-form... CAS#:51264-73-4 |
| Literature: Nissan Chemical Industries Ltd. Patent: US4537984 A1, 1985 ; |
|
~%
ethyl 2-(4-form... CAS#:51264-73-4 |
| Literature: Sashidhara, Koneni V.; Kumar, Manoj; Sonkar, Ravi; Singh, Bhanu Shankar; Khanna; Bhatia, Gitika Journal of Medicinal Chemistry, 2012 , vol. 55, # 6 p. 2769 - 2779 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 257-095-9 |