2'-O-Methylisoliquiritigenin structure
|
Common Name | 2'-O-Methylisoliquiritigenin | ||
|---|---|---|---|---|
| CAS Number | 51828-10-5 | Molecular Weight | 270.280 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 527.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.5±23.6 °C | |
Use of 2'-O-Methylisoliquiritigenin2'-O-Methylisoliquiritigenin, isolated from the Arachis species, up-regulates 5-HT, NE, DA and GABA pathways, but does not put a very significant effect on ne NE pathway[1]. |
| Name | 1-(4-hydroxy-2-methoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | 2'-O-Methylisoliquiritigenin, isolated from the Arachis species, up-regulates 5-HT, NE, DA and GABA pathways, but does not put a very significant effect on ne NE pathway[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 527.1±50.0 °C at 760 mmHg |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.280 |
| Flash Point | 200.5±23.6 °C |
| Exact Mass | 270.089203 |
| PSA | 66.76000 |
| LogP | 2.96 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | PACBGANPVNHGNP-UHFFFAOYSA-N |
| SMILES | COc1cc(O)ccc1C(=O)C=Cc1ccc(O)cc1 |
| Hazard Codes | Xi |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| 4,4'-dihydroxy-2'-methoxychalcone |
| 2-Propen-1-one, 1-(4-hydroxy-2-methoxyphenyl)-3-(4-hydroxyphenyl)-, (2E)- |
| 6H-Benzofuro[3,2-c][1]benzopyran-3-ol, 6a,11a-dihydro-9-methoxy-, (6aR-cis)- |
| UNII-6TX086I6IG |
| (-)-3-Hydroxy-9-methoxypterocarpan |
| Demethylhomopterocarpin |
| Medicarpin |
| (2E)-1-(4-Hydroxy-2-methoxyphenyl)-3-(4-hydroxyphenyl)-2-propen-1-one |
| (6aR,11aR)-9-Methoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromen-3-ol |
| 6H-Benzofuro[3,2-c][1]benzopyran-3-ol, 6a,11a-dihydro-9-methoxy-, (6aR,11aR)- |
| (6aR-cis)-6a,11a-Dihydro-9-methoxy-6H-benzofuro[3,2-c][1]benzopyran-3-ol |
| (2E)-1-(4-hydroxy-2-methoxyphenyl)-3-(4-hydroxyphenyl)prop-2-en-1-one |
| Medicarpin, (-)- |