DICYCLOHEXYLACETIC ACID structure
|
Common Name | DICYCLOHEXYLACETIC ACID | ||
|---|---|---|---|---|
| CAS Number | 52034-92-1 | Molecular Weight | 224.33900 | |
| Density | 1.04g/cm3 | Boiling Point | 353.2ºC at 760 mmHg | |
| Molecular Formula | C14H24O2 | Melting Point | 139-141ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 172.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,2-dicyclohexylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 353.2ºC at 760 mmHg |
| Melting Point | 139-141ºC(lit.) |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.33900 |
| Flash Point | 172.6ºC |
| Exact Mass | 224.17800 |
| PSA | 37.30000 |
| LogP | 3.84780 |
| Index of Refraction | 1.506 |
| InChIKey | PGGMEZOUAPIYOY-UHFFFAOYSA-N |
| SMILES | O=C(O)C(C1CCCCC1)C1CCCCC1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2916209090 |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|
Colloidal properties of single component naphthenic acids and complex naphthenic acid mixtures.
J. Colloid. Interface Sci. 395 , 104-10, (2013) Tensiometry was used to provide estimates of the critical micelle concentration (cmc) values for three sources of naphthenic acids (NAs) and three examples of single component NAs (S1-S3) in aqueous s... |
|
|
Excited precursor reactivity, fast 1, 2-H shifts, and diffusion-controlled methanol insertion in 1, 2-Diphenylalkylidenes. Motschiedler K, et al.
J. Org. Chem. 64(14) , 5139-47, (1999)
|
|
|
catena-Poly [[trimethyltin (IV)]--2, 2-dicyclohexylacetato-2O: O′]. Cheikh AKD, et al.
Acta Crystallogr. Sect. E Struct. Rep. Online 63(1) , m258-m260, (2006)
|
| Dodekahydrodiphenylessigsaeure |
| Perhydrodiphenylessigsaeure |
| bis-cyclohexyl acetic acid |
| Dicyclohexyl-essigsaeure |
| MFCD00075017 |
| Dicyclohexylacetic acid |