Karanjin structure
|
Common Name | Karanjin | ||
|---|---|---|---|---|
| CAS Number | 521-88-0 | Molecular Weight | 292.285 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 463.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H12O4 | Melting Point | 156ºC | |
| MSDS | N/A | Flash Point | 233.8±28.7 °C | |
Use of KaranjinKaranjin is a major active furanoflavonol constituent of Fordia cauliflora. Karanjin induces GLUT4 translocation in skeletal muscle cells by increasing AMPK activity. Karanjin can induce cancer cell death through cell cycle arrest and enhance apoptosis[1][2]. |
| Name | 3-Methoxy-2-phenyl-4H-furo[2,3-h]chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Karanjin is a major active furanoflavonol constituent of Fordia cauliflora. Karanjin induces GLUT4 translocation in skeletal muscle cells by increasing AMPK activity. Karanjin can induce cancer cell death through cell cycle arrest and enhance apoptosis[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 463.0±45.0 °C at 760 mmHg |
| Melting Point | 156ºC |
| Molecular Formula | C18H12O4 |
| Molecular Weight | 292.285 |
| Flash Point | 233.8±28.7 °C |
| Exact Mass | 292.073547 |
| PSA | 52.58000 |
| LogP | 3.29 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.678 |
| InChIKey | LKPQNZRGGNOPPU-UHFFFAOYSA-N |
| SMILES | COc1c(-c2ccccc2)oc2c(ccc3occc32)c1=O |
| Safety Phrases | S22-S24/25 |
|---|---|
| RTECS | DX1500000 |
| HS Code | 2932999099 |
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Karanjin |
| 4H-Furo[2,3-h]-1-benzopyran-4-one, 3-methoxy-2-phenyl- |
| 3-Methoxy-2-phenyl-4H-furo[2,3-h]-1-benzopyran-4-one |
| 3-Methoxy-2-phenyl-4H-furo[2,3-h]chromen-4-one |
| 3-methoxy-2-phenylfuro[2,3-h]chromen-4-one |
| MFCD01740600 |
| 3-Methoxy-2-phenyl-4H-furo(2,3-h)(1)benzopyran-4-one |