Oxeladin (citrate) structure
|
Common Name | Oxeladin (citrate) | ||
|---|---|---|---|---|
| CAS Number | 52432-72-1 | Molecular Weight | 527.60400 | |
| Density | N/A | Boiling Point | 609.1ºC at 760 mmHg | |
| Molecular Formula | C26H41NO10 | Melting Point | 90-91° | |
| MSDS | Chinese USA | Flash Point | 322.2ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
Use of Oxeladin (citrate)Oxeladin citrate is a cough suppressant, is a highly potent and effective drug used to treat all types of cough of various etiologies. |
| Name | 2-[2-(diethylamino)ethoxy]ethyl 2-ethyl-2-phenylbutanoate,2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Oxeladin citrate is a cough suppressant, is a highly potent and effective drug used to treat all types of cough of various etiologies. |
|---|---|
| Related Catalog |
| Boiling Point | 609.1ºC at 760 mmHg |
|---|---|
| Melting Point | 90-91° |
| Molecular Formula | C26H41NO10 |
| Molecular Weight | 527.60400 |
| Flash Point | 322.2ºC |
| Exact Mass | 527.27300 |
| PSA | 170.90000 |
| LogP | 2.39750 |
| InChIKey | KVKJFNUGVOFNGU-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOCCOC(=O)C(CC)(CC)c1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| Storage condition | -20℃ |
| Water Solubility | Freely soluble in water, slightly to very slightly soluble in ethyl acetate. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311 + H331 |
| Precautionary Statements | Missing Phrase - N15.00950417-P261-P280-P302 + P352 + P312-P304 + P340 + P312-P403 + P233 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Phrases | 23/24/25 |
| Safety Phrases | 36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | ET1760000 |
|
High performance liquid chromatographic determination of oxeladin citrate and oxybutynin hydrochloride and their degradation products.
Il Farmaco 60(8) , 689-99, (2005) Two high performance liquid chromatographic (HPLC) methods are presented for the determination of oxeladin citrate (OL) and oxybutynin hydrochloride (OB) and their degradation products. The first meth... |
|
|
Determination of oxeladin in human sera by gas--liquid chromatography with thermionic detection.
J. Chromatogr. A. 225(2) , 463-8, (1981)
|
|
|
[Determination of oxeladin citrate in drug combinations].
Pharmazie 37(1) , 76-7, (1982)
|
| Bio-0361 |
| HMS3264M05 |
| Oxeladin citrate salt |
| oxeladin dihydrogen citrate |
| oxeladin citrate |
| Oxeladin-zitrat |
| Oxeladin (citrate) |