3-Chloro-4-[(pyridin-2-yl)methyloxy]aniline structure
|
Common Name | 3-Chloro-4-[(pyridin-2-yl)methyloxy]aniline | ||
|---|---|---|---|---|
| CAS Number | 524955-09-7 | Molecular Weight | 234.682 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 402.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C12H11ClN2O | Melting Point | 93 °C | |
| MSDS | N/A | Flash Point | 197.2±25.9 °C | |
| Name | 3-chloro-4-(pyridin-2-ylmethoxy)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 402.5±35.0 °C at 760 mmHg |
| Melting Point | 93 °C |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 234.682 |
| Flash Point | 197.2±25.9 °C |
| Exact Mass | 234.055984 |
| PSA | 48.14000 |
| LogP | 1.74 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | XCAPJQSICQSUJP-UHFFFAOYSA-N |
| SMILES | Nc1ccc(OCc2ccccn2)c(Cl)c1 |
| HS Code | 2933399090 |
|---|
|
~95%
3-Chloro-4-[(py... CAS#:524955-09-7 |
| Literature: WYETH Patent: US2006/270668 A1, 2006 ; Location in patent: Page/Page column 16-17 ; |
|
~94%
3-Chloro-4-[(py... CAS#:524955-09-7 |
| Literature: ASTRAZENECA AB; ASTRAZENECA UK LIMITED Patent: WO2006/64196 A1, 2006 ; Location in patent: Page/Page column 97 ; WO 2006/064196 A1 |
|
~32%
3-Chloro-4-[(py... CAS#:524955-09-7 |
| Literature: Gavai, Ashvinikumar V.; Han, Wen-Ching; Chen, Ping; Ruediger, Edward H.; Mastalerz, Harold; Fink, Brian E.; Norris, Derek J. Patent: US2005/197339 A1, 2005 ; Location in patent: Page/Page column 12 ; US 20050197339 A1 |
|
~%
3-Chloro-4-[(py... CAS#:524955-09-7 |
| Literature: Tianjin Hemay Bio-Tech Co., Ltd.; Zhang, Hesheng; Chen, Yingwei; He, Qingchao Patent: US2013/225579 A1, 2013 ; |
|
~%
3-Chloro-4-[(py... CAS#:524955-09-7 |
| Literature: KANIONUSA INC.; SHEN, Wang; ZHANG, Aimin; FAN, Junfa; ZHENG, Xiaoling Patent: WO2011/2523 A1, 2011 ; WO 2011/002523 A1 |
|
~%
3-Chloro-4-[(py... CAS#:524955-09-7 |
| Literature: KANIONUSA INC.; SHEN, Wang; ZHANG, Aimin; FAN, Junfa; ZHENG, Xiaoling Patent: WO2011/2523 A1, 2011 ; WO 2011/002523 A1 |
|
~%
3-Chloro-4-[(py... CAS#:524955-09-7 |
| Literature: Gu, Ning; Yang, Jiabin; Wang, Peng; Li, Lushen; Chen, Yang; Ji, Min Research on Chemical Intermediates, 2013 , vol. 39, # 7 p. 3105 - 3110 |
| Precursor 6 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-CHLORO-4-((PYRIDIN-2-YL)METHOXY)ANILINE |
| 3-chloro-4-(2-pyridinylMethoxy)-BenzenaMine |
| Benzenamine, 3-chloro-4-(2-pyridinylmethoxy)- |
| 3-chloro-4-(pyridin-2-ylmethoxy)aniline |
| 3-chloro-4-(pyridine-2-ylmethoxy)aniline |
| 3-Chloro-4-(2-pyridinylmethoxy)aniline |
| 4-pyridin-2-yl-methoxy-3-chloroaniline |
| Benzenamine,3-chloro-4-(2-pyridinylmethoxy) |
| 3-chloro-4-(pyridin-2-yl-methoxy)benzenamine |
| 3-Chloro-4-[(pyridin-2-yl)methyloxy]aniline |