[D-Lys6]-LH-RH structure
|
Common Name | [D-Lys6]-LH-RH | ||
|---|---|---|---|---|
| CAS Number | 52671-12-2 | Molecular Weight | 340.31000 | |
| Density | 1.51g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C19H17O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of [D-Lys6]-LH-RH[D-Lys6]-LH-RH is a Luteinizing-hormone-releasing hormone (LHRH) analogue. [D-Lys6]-LH-RH acts as a GnRH receptor agonist[1]. |
| Name | pyr-his-trp-ser-tyr-d-lys-leu-arg-pro-gly-nh2 |
|---|
| Description | [D-Lys6]-LH-RH is a Luteinizing-hormone-releasing hormone (LHRH) analogue. [D-Lys6]-LH-RH acts as a GnRH receptor agonist[1]. |
|---|---|
| Related Catalog | |
| In Vivo | [D-Lys6]-LH-RH (100 μg, minipumps implanted subcutaneously) inhibits tumor growth in Dunning R-3327H prostate cancer rats[1]. Animal Model: Dunning R-3327H prostate cancer rats[1] Dosage: 100 μg Administration: Alzet minipumps implanted subcutaneously Result: Inhibited tumor growth compared with control. |
| Density | 1.51g/cm3 |
|---|---|
| Molecular Formula | C19H17O4P |
| Molecular Weight | 340.31000 |
| Exact Mass | 340.08600 |
| PSA | 65.57000 |
| LogP | 5.02860 |
| Index of Refraction | 1.703 |
| InChIKey | HOWBSMILMYIFKQ-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)C(CCCCN)NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CO)NC(=O)C(Cc1c[nH]c2ccccc12)NC(=O)C(Cc1cnc[nH]1)NC(=O)C1CCC(=O)N1)C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)NCC(N)=O |
| Risk Phrases | 60 |
|---|---|
| Safety Phrases | 53-22-36/37/39-45 |