Cellobiose structure
|
Common Name | Cellobiose | ||
|---|---|---|---|---|
| CAS Number | 528-50-7 | Molecular Weight | 342.297 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 667.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C12H22O11 | Melting Point | 239 °C (dec.)(lit.) | |
| MSDS | USA | Flash Point | 357.8±31.5 °C | |
Use of CellobioseD-(+)-Cellobiose is a substrate of β-glucosidase. |
| Name | cellobiose |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 667.9±55.0 °C at 760 mmHg |
| Melting Point | 239 °C (dec.)(lit.) |
| Molecular Formula | C12H22O11 |
| Molecular Weight | 342.297 |
| Flash Point | 357.8±31.5 °C |
| Exact Mass | 342.116211 |
| PSA | 189.53000 |
| LogP | -3.41 |
| Vapour Pressure | 0.0±4.6 mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | GUBGYTABKSRVRQ-QRZGKKJRSA-N |
| SMILES | OCC1OC(OC2C(CO)OC(O)C(O)C2O)C(O)C(O)C1O |
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 29400090 |
|---|
|
Fungal diversity in deep-sea hydrothermal ecosystems.
Appl. Environ. Microbiol. 75(20) , 6415-21, (2009) Deep-sea hydrothermal ecosystems are considered oases of life in oceans. Since the discovery of these ecosystems in the late 1970s, many endemic species of Bacteria, Archaea, and other organisms, such... |
|
|
Fast carbohydrate analysis via liquid chromatography coupled with ultra violet and electrospray ionization ion trap detection in 96-well format.
J. Chromatogr. A. 1350 , 44-50, (2014) A fast carbohydrate screening platform processible in 96-well format is described. The method is suitable for the determination of various carbohydrates out of complex mixtures as obtained by acidic h... |
| (2R,3R,4R,5S,6R)-6-(Hydroxymethyl)-5-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl]oxy}tetrahydro-2H-pyran-2,3,4-triol |
| D-Glucosyl-β-(1->;4)-D-glucose |
| D-glucosyl-β-(1-4)-D-glucose |
| β-D-glucosyl-(1->;4)-β-D-glucose |
| β-D-Glc-(1->4)-β-D-Glc |
| GLC1-B-4-D-GLC |
| β-cellobiose |
| 4-(β-δ-Glucosido)-δ-glucose |
| δ-(+)-Cellobiose |
| D(+)-Cellobiose |
| 4-beta-d-glucopyransoyl-d-glucopyranose |
| D-(+)-Cellose |
| 4-O-β-δ-Glucopyranosyl-δ-glucose |
| β-D-glucopyranosyl-(1->4)-β-D-glucopyranose |
| 4-(b-δ-Glucosido)-δ-glucose |
| b-Cellobiose |
| Cellobiose |
| 4-(β-D-glucosido)-D-glucose |
| EINECS 208-436-5 |
| 4-(b-D-Glucosido)-D-glucose |
| δ-Cellobiose |
| D-(+)-Cellobiose |
| D-Cellbiose |
| D-Glucosyl-b-(1®4)-D-glucose |
| CELLOSE |
| (2R,3R,4R,5S,6R)-6-(Hydroxyméthyl)-5-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxyméthyl)tétrahydro-2H-pyran-2-yl]oxy}tétrahydro-2H-pyran-2,3,4-triol |
| GLC-BETA1,4GLC |
| MFCD00136034 |
| β-D-Glucopyranose, 4-O-β-D-glucopyranosyl- |
| 4-O-β-D-Glucopyranosyl-β-D-glucopyranose |
| 1-β-D-Glucopyranosyl-4-β-D-glucopyranose |
| 4-β-D-glucopyranosyl-D-glucopyranose |
| Cellobiose (8CI) |
| D-Cellobiose |