Azaleatin structure
|
Common Name | Azaleatin | ||
|---|---|---|---|---|
| CAS Number | 529-51-1 | Molecular Weight | 316.26200 | |
| Density | 1.634g/cm3 | Boiling Point | 657.3ºC at 760mmHg | |
| Molecular Formula | C16H12O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.2ºC | |
Use of AzaleatinAzaleatin is an O-methylated flavonol isolated from Rhododendron species. Azaleatin is a dipeptidyl peptidase-IV inhibitor. Azaleatin can be used for the research of type-2 diabetes and obesity[1][2]. |
| Name | azaleatin |
|---|---|
| Synonym | More Synonyms |
| Description | Azaleatin is an O-methylated flavonol isolated from Rhododendron species. Azaleatin is a dipeptidyl peptidase-IV inhibitor. Azaleatin can be used for the research of type-2 diabetes and obesity[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Dipeptidyl Peptidase-IV Inhibitor[2] |
| References |
| Density | 1.634g/cm3 |
|---|---|
| Boiling Point | 657.3ºC at 760mmHg |
| Molecular Formula | C16H12O7 |
| Molecular Weight | 316.26200 |
| Flash Point | 250.2ºC |
| Exact Mass | 316.05800 |
| PSA | 120.36000 |
| LogP | 2.29100 |
| Index of Refraction | 1.74 |
| InChIKey | RJBAXROZAXAEEM-UHFFFAOYSA-N |
| SMILES | COc1cc(O)cc2oc(-c3ccc(O)c(O)c3)c(O)c(=O)c12 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Quercetin 5-methyl ether |
| 3,7,3',4'-tetrahydroxy-5-methoxyflavone |
| 2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-5-methoxychromen-4-one |
| Azaleatin |
| 5-O-Methyl Quercetin |