4-Phenylmethoxycarbonylaminobenzoic Acid structure
|
Common Name | 4-Phenylmethoxycarbonylaminobenzoic Acid | ||
|---|---|---|---|---|
| CAS Number | 5330-71-2 | Molecular Weight | 271.26800 | |
| Density | 1.342g/cm3 | Boiling Point | 425.1ºC at 760mmHg | |
| Molecular Formula | C15H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.9ºC | |
| Name | 4-(phenylmethoxycarbonylamino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.342g/cm3 |
|---|---|
| Boiling Point | 425.1ºC at 760mmHg |
| Molecular Formula | C15H13NO4 |
| Molecular Weight | 271.26800 |
| Flash Point | 210.9ºC |
| Exact Mass | 271.08400 |
| PSA | 75.63000 |
| LogP | 3.20650 |
| Index of Refraction | 1.649 |
| InChIKey | XRKLFEVNZWRMCT-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(C(=O)O)cc1)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~95%
4-Phenylmethoxy... CAS#:5330-71-2 |
| Literature: Vernall, Andrea J.; Stoddart, Leigh A.; Briddon, Stephen J.; Hill, Stephen J.; Kellam, Barrie Journal of Medicinal Chemistry, 2012 , vol. 55, # 4 p. 1771 - 1782 |
|
~81%
4-Phenylmethoxy... CAS#:5330-71-2 |
| Literature: Ikawa, Takashi; Sajiki, Hironao; Hirota, Kosaku Tetrahedron, 2005 , vol. 61, # 8 p. 2217 - 2231 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (4-Carboxy-phenyl)-carbamidsaeure-benzylester |
| 4-Benzyloxycarbonylamino-benzoesaeure |
| 4-N-benzyloxycarbonylaminobenzoic acid |
| Z-4-aminobenzoic acid |
| 4-benzyloxycarbonylamino-benzoic acid |
| 4-Phenylmethoxycarbonylaminobenzoic Acid |