N-[2-(2-nitrophenyl)ethyl]butan-1-amine structure
|
Common Name | N-[2-(2-nitrophenyl)ethyl]butan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 5339-14-0 | Molecular Weight | 222.28400 | |
| Density | 1.063g/cm3 | Boiling Point | 326.5ºC at 760 mmHg | |
| Molecular Formula | C12H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.2ºC | |
| Name | N-[2-(2-nitrophenyl)ethyl]butan-1-amine |
|---|
| Density | 1.063g/cm3 |
|---|---|
| Boiling Point | 326.5ºC at 760 mmHg |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.28400 |
| Flash Point | 151.2ºC |
| Exact Mass | 222.13700 |
| PSA | 57.85000 |
| LogP | 3.44110 |
| Index of Refraction | 1.529 |
| InChIKey | LHQGMHIIAQZMCI-UHFFFAOYSA-N |
| SMILES | CCCCNCCc1ccccc1[N+](=O)[O-] |
| HS Code | 2921199090 |
|---|
| HS Code | 2921199090 |
|---|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |