Isomaltitol structure
|
Common Name | Isomaltitol | ||
|---|---|---|---|---|
| CAS Number | 534-73-6 | Molecular Weight | 344.312 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 788.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C12H24O11 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 430.7±32.9 °C | |
Use of IsomaltitolIsomaltitol is a sugar alcohol sweet tastant. |
| Name | 6-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexane-1,2,3,4,5-pentol |
|---|---|
| Synonym | More Synonyms |
| Description | Isomaltitol is a sugar alcohol sweet tastant. |
|---|---|
| Related Catalog |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 788.5±60.0 °C at 760 mmHg |
| Molecular Formula | C12H24O11 |
| Molecular Weight | 344.312 |
| Flash Point | 430.7±32.9 °C |
| Exact Mass | 344.131866 |
| PSA | 200.53000 |
| LogP | -5.72 |
| Vapour Pressure | 0.0±6.2 mmHg at 25°C |
| Index of Refraction | 1.634 |
| InChIKey | SERLAGPUMNYUCK-YJOKQAJESA-N |
| SMILES | OCC(O)C(O)C(O)C(O)COC1OC(CO)C(O)C(O)C1O |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| 6-O-|A-D-Glucopyranosyl-D-glucitol |
| Isomaltitol |
| ISOMALTITOLE |
| EINECS 208-605-3 |
| MFCD00083636 |