diethyl 2-[(4-ethenylphenyl)methyl]propanedioate structure
|
Common Name | diethyl 2-[(4-ethenylphenyl)methyl]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 53413-52-8 | Molecular Weight | 276.32800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl 2-[(4-ethenylphenyl)methyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H20O4 |
|---|---|
| Molecular Weight | 276.32800 |
| Exact Mass | 276.13600 |
| PSA | 52.60000 |
| LogP | 2.61450 |
| InChIKey | GAZBIBNZQGIVRK-UHFFFAOYSA-N |
| SMILES | C=Cc1ccc(CC(C(=O)OCC)C(=O)OCC)cc1 |
|
~22%
diethyl 2-[(4-e... CAS#:53413-52-8 |
| Literature: Kamogawa, Hiroyoshi; Hirose, Tomoki; Nanasawa, Masato Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 11 p. 3517 - 3518 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Propanedioic acid,[(4-ethenylphenyl)methyl]-,diethyl ester |
| diethyl 2-(4-vinylbenzyl)malonate |
| Diethyl-p-vinylbenzylmalonat |