diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate
![diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate Structure](https://image.chemsrc.com/caspic/423/84184-50-9.png)
diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate structure
|
Common Name | diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 84184-50-9 | Molecular Weight | 356.41200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H24O5 |
|---|---|
| Molecular Weight | 356.41200 |
| Exact Mass | 356.16200 |
| PSA | 61.83000 |
| LogP | 3.55050 |
| InChIKey | DHIVGDFXQKJDMK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccc(OCc2ccccc2)cc1)C(=O)OCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![[p-(benzyloxy)benzyl] malonic acid, monoethyl ester structure](https://image.chemsrc.com/caspic/328/129673-18-3.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 4 | |
CAS#:50463-48-4
CAS#:61440-45-7
CAS#:10210-17-0
CAS#:24807-40-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| diethyl p-benzyloxybenzylmalonate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate? |
| A: SMILES notation of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate is CCOC(=O)C(Cc1ccc(OCc2ccccc2)cc1)C(=O)OCC. |
| Q: What is the English name of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate? |
| A: The English name of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate is diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate. |
| Q: What are the upstream materials of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate? |
| A: Related upstream materials(CAS) of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate: 105-53-3;836-42-0;100-39-0;836-43-1;623-05-2. |
| Q: What is the LogP of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate? |
| A: LogP of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate is 3.55050. |
| Q: What is the polar surface area (PSA) of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate? |
| A: Polar surface area (PSA) of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate is 61.83000. |
| Q: What is the Chinese name of 84184-50-9? |
| A: Chinese name of 84184-50-9 is 84184-50-9. |
| Q: What is the molecular formula of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate? |
| A: Molecular formula of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate is C21H24O5. |
| Q: What is the InChIKey of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate? |
| A: InChIKey of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate is DHIVGDFXQKJDMK-UHFFFAOYSA-N. |
| Q: What English synonyms does diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate have? |
| A: English synonyms of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate: diethyl p-benzyloxybenzylmalonate. |
| Q: What is the molecular weight of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate? |
| A: Molecular weight of diethyl 2-[(4-phenylmethoxyphenyl)methyl]propanedioate is 356.41200. |