2-Mercapto-4,6-di-tert-butylphenol structure
|
Common Name | 2-Mercapto-4,6-di-tert-butylphenol | ||
|---|---|---|---|---|
| CAS Number | 53551-74-9 | Molecular Weight | 238.38900 | |
| Density | 1.019g/cm3 | Boiling Point | 296ºC at 760 mmHg | |
| Molecular Formula | C14H22OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.8ºC | |
| Name | 2,4-ditert-butyl-6-sulfanylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.019g/cm3 |
|---|---|
| Boiling Point | 296ºC at 760 mmHg |
| Molecular Formula | C14H22OS |
| Molecular Weight | 238.38900 |
| Flash Point | 132.8ºC |
| Exact Mass | 238.13900 |
| PSA | 59.03000 |
| LogP | 4.27590 |
| Index of Refraction | 1.537 |
| InChIKey | SEUXZGMOSAXITB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(S)c(O)c(C(C)(C)C)c1 |
|
~99%
2-Mercapto-4,6-... CAS#:53551-74-9 |
| Literature: Pastor, Stephen D.; Denney, Dorothy Z. Journal of Heterocyclic Chemistry, 1988 , vol. 25, # 2 p. 681 - 683 |
|
~%
2-Mercapto-4,6-... CAS#:53551-74-9 |
| Literature: Kuliev, A. M.; Farzaliev, V. M.; Allakhverdiev, M. A.; Mamedov, Ch. I. J. Gen. Chem. USSR (Engl. Transl.), 1982 , vol. 52, # 9 p. 2122 - 2126,1889 - 1893 |
|
~13%
2-Mercapto-4,6-... CAS#:53551-74-9 |
| Literature: Sviridova; Laba; Vasil'ev; Litvinov Russian Chemical Bulletin, 2001 , vol. 50, # 3 p. 563 - 565 |
| 4,6-Di-tert-butyl-2-mercaptophenol |
| 3,5-di-tert-butyl-2-hydroxythiophenol |
| 2,4-Di-t-butyl-6-mercaptophenol |
| Phenol,2,4-di-tert-butyl-6-mercapto |
| 2,4-di-tert-butyl-6-mercaptophenol |
| 3,5-di-tert-butyl-2-hydroxybenzenethiol |
| 3,5-di-t-butyl-2-hydroxybenzenethiol |
| 2-Mercapto-4,6-di-tert-butylphenol |
| 2-sulfanyl-4,6-ditert-butyl-phenol |