2-Hydroxyterephthalic acid dimethyl ester structure
|
Common Name | 2-Hydroxyterephthalic acid dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 6342-72-9 | Molecular Weight | 210.18300 | |
| Density | 1.284g/cm3 | Boiling Point | 327.6ºC at 760 mmHg | |
| Molecular Formula | C10H10O5 | Melting Point | 92-93℃ | |
| MSDS | N/A | Flash Point | 127.9ºC | |
| Name | dimethyl 2-hydroxybenzene-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 327.6ºC at 760 mmHg |
| Melting Point | 92-93℃ |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18300 |
| Flash Point | 127.9ºC |
| Exact Mass | 210.05300 |
| PSA | 72.83000 |
| LogP | 0.96540 |
| Index of Refraction | 1.544 |
| InChIKey | CJOJIAKIRLKBOO-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(C(=O)OC)c(O)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918199090 |
| Precursor 10 | |
|---|---|
| DownStream 6 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| hydroxy-terephthalic acid dimethyl ester |
| hydroxy dimethyl terephthalate |
| Hydroxy-terephthalsaeure-dimethylester |
| dimethyl 2-hydroxyterephthalate |
| 2-Hydroxyterephthalsaeure-dimethylester |
| 2-hydroxyterephthalic acid dimethyl ester |