2-Butenedioic acid(2E)-, 1,4-bis(phenylmethyl) ester structure
|
Common Name | 2-Butenedioic acid(2E)-, 1,4-bis(phenylmethyl) ester | ||
|---|---|---|---|---|
| CAS Number | 538-64-7 | Molecular Weight | 296.31700 | |
| Density | 1.187g/cm3 | Boiling Point | 420.8ºC at 760mmHg | |
| Molecular Formula | C18H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.1ºC | |
| Name | 4-oxo-4-phenylmethoxybut-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.187g/cm3 |
|---|---|
| Boiling Point | 420.8ºC at 760mmHg |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.31700 |
| Flash Point | 209.1ºC |
| Exact Mass | 296.10500 |
| PSA | 52.60000 |
| LogP | 3.02940 |
| Index of Refraction | 1.574 |
| InChIKey | CPZVJYPXOWWFSW-VAWYXSNFSA-N |
| SMILES | O=C(C=CC(=O)OCc1ccccc1)OCc1ccccc1 |
| HS Code | 2917190090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| dibenzyl maleate |
| Fumarsaeure-dibenzylester |
| Benzylfumarate |
| 4-oxidanylidene-4-phenylmethoxy-but-2-enoate |
| 4-oxo-4-phenylmethoxy-2-butenoate |
| Dibenzyl fumarate |
| Dibenzylfumarat |