Ethyl 3-oxo-4-phenylbutanoate structure
|
Common Name | Ethyl 3-oxo-4-phenylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 5413-05-8 | Molecular Weight | 206.238 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 290.3±15.0 °C at 760 mmHg | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 123.9±20.4 °C | |
| Name | ethyl 3-oxo-2-phenylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 290.3±15.0 °C at 760 mmHg |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.238 |
| Flash Point | 123.9±20.4 °C |
| Exact Mass | 206.094299 |
| PSA | 43.37000 |
| LogP | 2.45 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.506 |
| InChIKey | PWRUKIPYVGHRFL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(C)=O)c1ccccc1 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-oxo-4-phenyl-butyric acid ethyl ester |
| ethyl 2-phenyl-3-oxobutanoate |
| Ethyl 2-phenylacetoacetate |
| Ethyl acetylphenylacetate |
| EINECS 226-500-0 |
| Benzenebutanoic acid, β-oxo-, ethyl ester |
| MFCD00040490 |
| 3-oxo-2-phenylbutyric acid ethyl ester |
| ethyl 2-phenyl-acetoacetate |
| 2-fenil-3-oxobutanoato di etile |
| Ethyl 3-oxo-4-phenylbutanoate |