2-carbamoylsulfanyl-N-(4-hydroxyphenyl)acetamide structure
|
Common Name | 2-carbamoylsulfanyl-N-(4-hydroxyphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 5428-97-7 | Molecular Weight | 226.25200 | |
| Density | 1.486g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H10N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | S-[2-(4-hydroxyanilino)-2-oxo-ethyl] carbamothioate |
|---|
| Density | 1.486g/cm3 |
|---|---|
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.25200 |
| Exact Mass | 226.04100 |
| PSA | 117.72000 |
| LogP | 1.91590 |
| Index of Refraction | 1.696 |
| InChIKey | SFFDVNRFDPEUET-UHFFFAOYSA-N |
| SMILES | NC(=O)SCC(=O)Nc1ccc(O)cc1 |
| HS Code | 2930200090 |
|---|
|
~%
2-carbamoylsulf... CAS#:5428-97-7 |
| Literature: Weiss Journal of the American Chemical Society, 1947 , vol. 69, p. 2682 |
|
~%
2-carbamoylsulf... CAS#:5428-97-7 |
| Literature: Lewenstein Patent: US2518154 , 1947 ; |
|
~%
2-carbamoylsulf... CAS#:5428-97-7 |
| Literature: Weiss Journal of the American Chemical Society, 1947 , vol. 69, p. 2682 |
| HS Code | 2930200090 |
|---|---|
| Summary | 2930200090 other thiocarbamates and dithiocarbamates。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |