butyl 3-chloro-4-hydroxy-5-methoxy-benzoate structure
|
Common Name | butyl 3-chloro-4-hydroxy-5-methoxy-benzoate | ||
|---|---|---|---|---|
| CAS Number | 5438-56-2 | Molecular Weight | 258.69800 | |
| Density | 1.224g/cm3 | Boiling Point | 360.7ºC at 760 mmHg | |
| Molecular Formula | C12H15ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.9ºC | |
| Name | butyl 3-chloro-4-hydroxy-5-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.224g/cm3 |
|---|---|
| Boiling Point | 360.7ºC at 760 mmHg |
| Molecular Formula | C12H15ClO4 |
| Molecular Weight | 258.69800 |
| Flash Point | 171.9ºC |
| Exact Mass | 258.06600 |
| PSA | 55.76000 |
| LogP | 3.01110 |
| Index of Refraction | 1.531 |
| InChIKey | DIVMDOLWRYXUNN-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1cc(Cl)c(O)c(OC)c1 |
| HS Code | 2918990090 |
|---|
|
~%
butyl 3-chloro-... CAS#:5438-56-2 |
| Literature: Pearl; Beyer Journal of the American Chemical Society, 1949 , vol. 71, p. 1066 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Chlor-4-hydroxy-5-methoxy-benzoesaeure-butylester |
| 3-chloro-4-hydroxy-5-methoxy-benzoic acid butyl ester |