octyl 3-chloro-4-hydroxy-5-methoxy-benzoate
Modify Date: 2025-09-22 10:04:23
octyl 3-chloro-4-hydroxy-5-methoxy-benzoate structure
|
Common Name | octyl 3-chloro-4-hydroxy-5-methoxy-benzoate | ||
|---|---|---|---|---|
| CAS Number | 5438-65-3 | Molecular Weight | 314.80400 | |
| Density | 1.135g/cm3 | Boiling Point | 414.9ºC at 760 mmHg | |
| Molecular Formula | C16H23ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.7ºC | |
| Name | 2-Furancarboxylic acid,5-chlorotetrahydro-,methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.135g/cm3 |
|---|---|
| Boiling Point | 414.9ºC at 760 mmHg |
| Molecular Formula | C16H23ClO4 |
| Molecular Weight | 314.80400 |
| Flash Point | 204.7ºC |
| Exact Mass | 314.12800 |
| PSA | 55.76000 |
| LogP | 4.57150 |
| Index of Refraction | 1.517 |
| InChIKey | IGWGSQPMOYAFTJ-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)c1cc(Cl)c(O)c(OC)c1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Chlor-vanillinsaeure-octylester |
| 5-Chlor-tetrahydrofuran-2-carbonsaeuremethylester |