Benzenamine,N-(4-methoxyphenyl)-2-nitro- structure
|
Common Name | Benzenamine,N-(4-methoxyphenyl)-2-nitro- | ||
|---|---|---|---|---|
| CAS Number | 54381-13-4 | Molecular Weight | 244.24600 | |
| Density | 1.276 g/cm3 | Boiling Point | 387.9ºC at 760 mmHg | |
| Molecular Formula | C13H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.4ºC | |
| Name | N-(4-methoxyphenyl)-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.276 g/cm3 |
|---|---|
| Boiling Point | 387.9ºC at 760 mmHg |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.24600 |
| Flash Point | 188.4ºC |
| Exact Mass | 244.08500 |
| PSA | 67.08000 |
| LogP | 3.94320 |
| Index of Refraction | 1.639 |
| InChIKey | JLIRPISIPQMEDU-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2ccccc2[N+](=O)[O-])cc1 |
| HS Code | 2922199090 |
|---|
|
~90%
Benzenamine,N-(... CAS#:54381-13-4 |
| Literature: Xu, Zhi-Bin; Lu, Ying; Guo, Zong-Ru Synlett, 2003 , # 4 p. 564 - 566 |
|
~83%
Benzenamine,N-(... CAS#:54381-13-4 |
| Literature: Lipshutz, Bruce H.; Chung, David W.; Rich, Brian Advanced Synthesis and Catalysis, 2009 , vol. 351, # 11-12 p. 1717 - 1721 |
|
~%
Benzenamine,N-(... CAS#:54381-13-4 |
| Literature: Tetrahedron Letters, , vol. 41, # 3 p. 355 - 358 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(4-Methoxyphenyl)-2-nitrobenzenamine |
| 4-Methoxy-2'-nitrodiphenylamine |
| (4-methoxy-phenyl)-(2-nitro-phenyl)-amine |
| 2-nitro-4'-methoxydiphenylamine |
| 4-methoxy-N-(2-nitrophenyl)benzenamine |
| MFCD03410307 |
| 4-methoxy-N-(2-nitrophenyl)aniline |
| N-(4'-methoxyphenyl)-2-nitrophenylamine |