2-ethyl-2-(2-phenoxyethyl)propanedioic acid structure
|
Common Name | 2-ethyl-2-(2-phenoxyethyl)propanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 5449-64-9 | Molecular Weight | 252.26300 | |
| Density | 1.25g/cm3 | Boiling Point | 487.9ºC at 760 mmHg | |
| Molecular Formula | C13H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.5ºC | |
| Name | 2-ethyl-2-(2-phenoxyethyl)propanedioic acid |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 487.9ºC at 760 mmHg |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.26300 |
| Flash Point | 187.5ºC |
| Exact Mass | 252.10000 |
| PSA | 83.83000 |
| LogP | 2.02110 |
| Index of Refraction | 1.545 |
| InChIKey | VINVCCQZJDSBAH-UHFFFAOYSA-N |
| SMILES | CCC(CCOc1ccccc1)(C(=O)O)C(=O)O |
|
~%
2-ethyl-2-(2-ph... CAS#:5449-64-9 |
| Literature: Blicke; Zienty Journal of the American Chemical Society, 1941 , vol. 63, p. 2779 |
|
~%
2-ethyl-2-(2-ph... CAS#:5449-64-9 |
| Literature: Blicke; Zienty Journal of the American Chemical Society, 1941 , vol. 63, p. 2779 |
|
~%
2-ethyl-2-(2-ph... CAS#:5449-64-9 |
| Literature: Blicke; Zienty Journal of the American Chemical Society, 1941 , vol. 63, p. 2779 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |