[4,7-dioctanoyloxy-9-(oxolan-2-yl)nonyl] octanoate structure
|
Common Name | [4,7-dioctanoyloxy-9-(oxolan-2-yl)nonyl] octanoate | ||
|---|---|---|---|---|
| CAS Number | 5453-34-9 | Molecular Weight | 624.93200 | |
| Density | 0.976g/cm3 | Boiling Point | 662.4ºC at 760 mmHg | |
| Molecular Formula | C37H68O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.6ºC | |
| Name | [4,7-di(octanoyloxy)-9-(oxolan-2-yl)nonyl] octanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.976g/cm3 |
|---|---|
| Boiling Point | 662.4ºC at 760 mmHg |
| Molecular Formula | C37H68O7 |
| Molecular Weight | 624.93200 |
| Flash Point | 264.6ºC |
| Exact Mass | 624.49700 |
| PSA | 88.13000 |
| LogP | 9.95430 |
| Index of Refraction | 1.468 |
| InChIKey | HVHIBEABFIOHNU-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OCCCC(CCC(CCC1CCCO1)OC(=O)CCCCCCC)OC(=O)CCCCCCC |
| HS Code | 2932190090 |
|---|
|
~%
[4,7-dioctanoyl... CAS#:5453-34-9 |
| Literature: Russell et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 726 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 9-(tetrahydrofuran-2-yl)nonane-1,4,7-triyl trioctanoate |
| 3,6,9-tris-octanoyloxy-1-tetrahydro[2]furyl-nonane |