[4-(2,4,4-trimethylpentan-2-yl)phenyl] acetate structure
|
Common Name | [4-(2,4,4-trimethylpentan-2-yl)phenyl] acetate | ||
|---|---|---|---|---|
| CAS Number | 5454-15-9 | Molecular Weight | 248.36100 | |
| Density | 0.955g/cm3 | Boiling Point | 316ºC at 760 mmHg | |
| Molecular Formula | C16H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111.9ºC | |
| Name | [4-(2,4,4-trimethylpentan-2-yl)phenyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.955g/cm3 |
|---|---|
| Boiling Point | 316ºC at 760 mmHg |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.36100 |
| Flash Point | 111.9ºC |
| Exact Mass | 248.17800 |
| PSA | 26.30000 |
| LogP | 4.32570 |
| Index of Refraction | 1.485 |
| InChIKey | RZULFCXKNQZRLL-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(C(C)(C)CC(C)(C)C)cc1 |
| HS Code | 2915390090 |
|---|
|
~%
[4-(2,4,4-trime... CAS#:5454-15-9 |
| Literature: Roehm and Haas Co. Patent: US2073316 , 1935 ; |
|
~%
[4-(2,4,4-trime... CAS#:5454-15-9 |
| Literature: Roehm and Haas Co. Patent: US2073316 , 1935 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 1-Acetoxy-4-(1,1,3,3-tetramethyl-butyl)-benzol |
| Essigsaeure-[4-(1.1.3.3-tetramethyl-butyl)-phenylester] |
| 1-acetoxy-4-(1,1,3,3-tetramethyl-butyl)-benzene |
| 4-(2,4,4-trimethylpentan-2-yl)phenyl acetate |