2-Nitrobenzenesulfonamide structure
|
Common Name | 2-Nitrobenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 5455-59-4 | Molecular Weight | 202.19 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 418.8±47.0 °C at 760 mmHg | |
| Molecular Formula | C6H6N2O4S | Melting Point | 189-194 °C | |
| MSDS | Chinese USA | Flash Point | 207.1±29.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 2-Nitrobenzenesulfonamide2-Nitrobenzenesulfonamide is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 2-Nitrobenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Nitrobenzenesulfonamide is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 418.8±47.0 °C at 760 mmHg |
| Melting Point | 189-194 °C |
| Molecular Formula | C6H6N2O4S |
| Molecular Weight | 202.19 |
| Flash Point | 207.1±29.3 °C |
| Exact Mass | 202.004822 |
| PSA | 114.36000 |
| LogP | 0.34 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | GNDKYAWHEKZHPJ-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccccc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S36/37/39-S26-S22-S37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2935009090 |
|
~76%
2-Nitrobenzenes... CAS#:5455-59-4 |
| Literature: WAKO PURE CHEM IND LTD Patent: JP2005/314398 A, 2005 ; Location in patent: Page/Page column 25 ; |
|
~%
2-Nitrobenzenes... CAS#:5455-59-4 |
| Literature: Tetrahedron Letters, , vol. 46, # 31 p. 5127 - 5130 |
|
~%
2-Nitrobenzenes... CAS#:5455-59-4 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 2169 - 2172 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Total synthesis of polyamine toxin HO-416b and Agel-489 using a 2-nitrobenzenesulfonamide strategy.
Chem. Pharm. Bull. 48(10) , 1570-6, (2000) Total synthesis of spider toxins HO-416b (1) and Agel-489 (2) was accomplished using the 2-nitrobenzenesulfonamide (Ns) group as both a protecting and activating group. In this strategy, the C-N bonds... |
| 2-Nitrobenzenesulfonamide |
| nitrobenzenesulfonamide |
| 2-Nitro-benzenesulfonamide |
| Benzenesulfonamide, 2-nitro- |
| 2-Sulphamoylnitrobenzene |
| 2-Nitrobenzenesulphonamide |
| o-nitrobenzenesulfonamide |
| MFCD00009807 |
| O-Nitrobenzenesulfonylamide |
| nitrophenylsulphonamide |
| 1-(2-Methoxyphenyl)piperazine hydrochloride |