2-[4-(Diethylamino)-2-hydroxybenzoyl]benzoic acid structure
|
Common Name | 2-[4-(Diethylamino)-2-hydroxybenzoyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 5809-23-4 | Molecular Weight | 313.348 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 537.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H19NO4 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 278.7±28.7 °C | |
| Name | 2-(4-Diethylamino-2-hydroxybenzoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 537.1±45.0 °C at 760 mmHg |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.348 |
| Flash Point | 278.7±28.7 °C |
| Exact Mass | 313.131409 |
| PSA | 77.84000 |
| LogP | 3.97 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | FQNKTJPBXAZUGC-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(C(=O)c2ccccc2C(=O)O)c(O)c1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
|
~65%
2-[4-(Diethylam... CAS#:5809-23-4 |
| Literature: Riken Patent: US8134017 B1, 2012 ; Location in patent: Page/Page column 26 ; |
|
~72%
2-[4-(Diethylam... CAS#:5809-23-4 |
| Literature: Liu, Qing-Hao; Liu, Jia; Guo, Jin-Chun; Yan, Xi-Long; Wang, Dong-Hua; Chen, Lei; Yan, Fan-Yong; Chen, Li-Gong Journal of Materials Chemistry, 2009 , vol. 19, # 14 p. 2018 - 2025 |
|
~%
2-[4-(Diethylam... CAS#:5809-23-4 |
| Literature: US8134017 B1, ; |
|
~%
2-[4-(Diethylam... CAS#:5809-23-4 |
| Literature: US8134017 B1, ; |
|
~%
2-[4-(Diethylam... CAS#:5809-23-4 |
| Literature: Chemical Communications, , vol. 48, # 5 p. 750 - 752 |
|
~%
2-[4-(Diethylam... CAS#:5809-23-4 |
| Literature: Arch. Sci. phys. nat. Geneve, vol. <3> 30, p. 92 |
|
~%
2-[4-(Diethylam... CAS#:5809-23-4 |
| Literature: DE85931 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 4, p. 261 |
| Precursor 7 | |
|---|---|
| DownStream 6 | |
| MFCD00134669 |
| 2-{[4-(diethylamino)-2-hydroxyphenyl]carbonyl}benzoic acid |
| EINECS 227-370-8 |
| 2-[4-(Diethylamino)-2-hydroxybenzoyl]benzoic acid |
| Benzoic acid, 2-[4-(diethylamino)-2-hydroxybenzoyl]- |