Benzenesulfonic acid,2,4,6-trimethyl-, phenyl ester structure
|
Common Name | Benzenesulfonic acid,2,4,6-trimethyl-, phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 5465-84-9 | Molecular Weight | 276.35100 | |
| Density | 1.191g/cm3 | Boiling Point | 415.5ºC at 760mmHg | |
| Molecular Formula | C15H16O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.1ºC | |
| Name | phenyl 2,4,6-trimethylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.191g/cm3 |
|---|---|
| Boiling Point | 415.5ºC at 760mmHg |
| Molecular Formula | C15H16O3S |
| Molecular Weight | 276.35100 |
| Flash Point | 205.1ºC |
| Exact Mass | 276.08200 |
| PSA | 51.75000 |
| LogP | 4.46030 |
| Index of Refraction | 1.568 |
| InChIKey | BBTGZLICINVWQG-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(S(=O)(=O)Oc2ccccc2)c(C)c1 |
| HS Code | 2906299090 |
|---|
|
~90%
Benzenesulfonic... CAS#:5465-84-9 |
| Literature: Horner, Leopold; Schmitt, Rolf-Erhard Phosphorus and Sulfur and the Related Elements, 1982 , vol. 13, p. 189 - 212 |
|
~%
Benzenesulfonic... CAS#:5465-84-9 |
| Literature: Leandri et al. Annali di Chimica (Rome, Italy), 1959 , vol. 49, p. 407,418,421 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,4,6-Trimethyl-benzolsulfonsaeure-phenylester |
| phenyl mesitylenesulfonate |
| mesitylenesulfonic acid phenylester |
| 2,4,6-trimethyl-benzenesulfonic acid phenyl ester |
| Phenylmesitylensulfonat |