ethyl 2-(cyclohexylmethyl)-3-oxo-butanoate structure
|
Common Name | ethyl 2-(cyclohexylmethyl)-3-oxo-butanoate | ||
|---|---|---|---|---|
| CAS Number | 5469-47-6 | Molecular Weight | 226.31200 | |
| Density | 0.994g/cm3 | Boiling Point | 303.7ºC at 760mmHg | |
| Molecular Formula | C13H22O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-cyclohexylmethyl-acetoacetic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 0.994g/cm3 |
|---|---|
| Boiling Point | 303.7ºC at 760mmHg |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.31200 |
| Exact Mass | 226.15700 |
| PSA | 43.37000 |
| LogP | 2.72510 |
| Index of Refraction | 1.456 |
| InChIKey | BHRDSMFTTKGJGW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC1CCCCC1)C(C)=O |
| HS Code | 2918300090 |
|---|
|
~%
ethyl 2-(cycloh... CAS#:5469-47-6 |
| Literature: Vaughan; Andersen Journal of the American Chemical Society, 1955 , vol. 77, p. 6702 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl-2-aceto-3-cyclohexylpropanoate |
| 2-Cyclohexylmethyl-acetessigsaeure-aethylester |