Adenosine triphosphate structure
|
Common Name | Adenosine triphosphate | ||
|---|---|---|---|---|
| CAS Number | 56-65-5 | Molecular Weight | 507.181 | |
| Density | 2.6±0.1 g/cm3 | Boiling Point | 951.4±75.0 °C at 760 mmHg | |
| Molecular Formula | C10H16N5O13P3 | Melting Point | 187 - 190ºC (Decomposes) | |
| MSDS | N/A | Flash Point | 529.2±37.1 °C | |
Use of Adenosine triphosphateATP is a central component of energy storage and metabolism in vivo, provides the metabolic energy to drive metabolic pumps and serves as a coenzyme in cells. |
| Name | atp |
|---|---|
| Synonym | More Synonyms |
| Description | ATP is a central component of energy storage and metabolism in vivo, provides the metabolic energy to drive metabolic pumps and serves as a coenzyme in cells. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| In Vitro | ATP (100-300 µM) inhibits the production of TNF-α by 32±8%, and at 300 µM, the attenuation of TNF-α production is 65±4% in LPS + PHA-stimulated whole blood. ATP (100, 300 µM) increases IL-10 levels by 48±5% (p=0.01) and 62±7%, respectively, in LPS + PHA-stimulated whole blood. ATP does not significantly alter the production of IL-6. |
| References |
| Density | 2.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 951.4±75.0 °C at 760 mmHg |
| Melting Point | 187 - 190ºC (Decomposes) |
| Molecular Formula | C10H16N5O13P3 |
| Molecular Weight | 507.181 |
| Flash Point | 529.2±37.1 °C |
| Exact Mass | 506.995758 |
| PSA | 308.56000 |
| LogP | -4.18 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.904 |
| InChIKey | ZKHQWZAMYRWXGA-KQYNXXCUSA-N |
| SMILES | Nc1ncnc2c1ncn2C1OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C1O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S22-S24/25 |
| WGK Germany | 3 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| atipi |
| Fosfobion |
| Adenosine tetrahydrogen triphosphate |
| Adenosine, 5'-(tetrahydrogen triphosphate) |
| adenosine-triphosphate |
| Striphos |
| Adenosine 5'-triphosphorate |
| Triadesin A |
| adetol |
| Adenosine 5'-(tetrahydrogen triphosphate) |
| Triphosadenine |
| adephos |
| MFCD00065467 |
| EINECS 200-283-2 |
| Adenosine triphosphate |
| Adenosine-5'-triphosphate |
| Adetide |
| 5'-Atp |
| adynol |
| striadyne |
| Adenosinetriphosphate |
| atriphos |
| adenosine-5′-triphosphate |
| adenosine 5'-triphosphoric acid |
| Adenosine 5'-triphosphate |
| Cardenosine |
| adenosine 5′-triphosphate |
| Phosphobion |
| ATP |
| Adenphos |