Phenyl 1,4-Dihydroxy-2-naphthoate structure
|
Common Name | Phenyl 1,4-Dihydroxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 54978-55-1 | Molecular Weight | 280.27500 | |
| Density | 1.375 g/cm3 | Boiling Point | 505.4ºC at 760 mmHg | |
| Molecular Formula | C17H12O4 | Melting Point | 156°C | |
| MSDS | N/A | Flash Point | 191.8ºC | |
| Name | Phenyl 1,4-Dihydroxy-2-naphthoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.375 g/cm3 |
|---|---|
| Boiling Point | 505.4ºC at 760 mmHg |
| Melting Point | 156°C |
| Molecular Formula | C17H12O4 |
| Molecular Weight | 280.27500 |
| Flash Point | 191.8ºC |
| Exact Mass | 280.07400 |
| PSA | 66.76000 |
| LogP | 3.47020 |
| Index of Refraction | 1.708 |
| InChIKey | XDUXGEPGVNWEBQ-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccccc1)c1cc(O)c2ccccc2c1O |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2918290000 |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| EINECS 259-419-4 |
| MFCD00075770 |
| phenyl 1,4-dihydroxynaphthalene-2-carboxylate |